CAS 1706446-21-0 appears in our catalog under these names: 2,3-Difluoro-5-methoxy-4-methylbenzoic acid, 95%, 2,3-Difluoro-5-methoxy-4-methylbenzoic acid, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 1g, 5g.
2,3-difluoro-5-methoxy-4-methylbenzoic acid (CAS 1706446-21-0) is a chemical compound with the molecular formula C9H8F2O3 and a molecular weight of 202.15 g/mol. IUPAC name: 2,3-difluoro-5-methoxy-4-methylbenzoic acid. InChIKey: TUROBCVVJCQNJG-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O3 |
|---|---|
| Molecular weight | 202.15 g/mol |
| IUPAC name | 2,3-difluoro-5-methoxy-4-methylbenzoic acid |
| InChIKey | TUROBCVVJCQNJG-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C(=C1F)F)C(=O)O)OC |
Computed by PubChem (NCBI)