Products 1706446-21-0

CAS 1706446-21-0 appears in our catalog under these names: 2,3-Difluoro-5-methoxy-4-methylbenzoic acid, 95%, 2,3-Difluoro-5-methoxy-4-methylbenzoic acid, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

2,3-difluoro-5-methoxy-4-methylbenzoic acid (CAS 1706446-21-0) is a chemical compound with the molecular formula C9H8F2O3 and a molecular weight of 202.15 g/mol. IUPAC name: 2,3-difluoro-5-methoxy-4-methylbenzoic acid. InChIKey: TUROBCVVJCQNJG-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8F2O3
Molecular weight202.15 g/mol
IUPAC name2,3-difluoro-5-methoxy-4-methylbenzoic acid
InChIKeyTUROBCVVJCQNJG-UHFFFAOYSA-N
SMILESCC1=C(C=C(C(=C1F)F)C(=O)O)OC

Computed by PubChem (NCBI)