CAS 1027513-97-8 appears in our catalog under these names: Difluoro(4-methoxyphenyl)acetic acid, 95-<97%, difluoro(4-methoxyphenyl)acetic acid, 95%, 2,2–difluoro–2–(4–methoxyphenyl)acetic acid, alpha,alpha-Difluoro-2-(4-methoxyphenyl)acetic acid, α,α-Difluoro-4-methoxybenzeneacetic acid. Offered by: Hoffman Fine Chemicals, Combi-blocks, GLPBio, Biosynth, Chemat. Available pack sizes: 10g, 25g, 50g, 1g, 100mg, 5g, 250mg, 0,5g.
2,2-difluoro-2-(4-methoxyphenyl)acetic acid (CAS 1027513-97-8) is a chemical compound with the molecular formula C9H8F2O3 and a molecular weight of 202.15 g/mol. IUPAC name: 2,2-difluoro-2-(4-methoxyphenyl)acetic acid. InChIKey: AVTZQAFEAUPCKL-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O3 |
|---|---|
| Molecular weight | 202.15 g/mol |
| IUPAC name | 2,2-difluoro-2-(4-methoxyphenyl)acetic acid |
| InChIKey | AVTZQAFEAUPCKL-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(C(=O)O)(F)F |
Computed by PubChem (NCBI)