cas: 92028-57-4 — see every product listed under this CAS number, including other names
2-(2,5-Dimethyl-1H-pyrrol-1-yl)benzoic acid, 97% (CAS 92028-57-4) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g, 5g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | CC39901CB |
| cas | 92028-57-4 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 151.20 Pln | |
| Thermo Scientific | 1g | 395.05 Pln | |
| Thermo Scientific | 5g | 1267.61 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
2-(2,5-dimethylpyrrol-1-yl)benzoic acid (CAS 92028-57-4) is a chemical compound with the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. IUPAC name: 2-(2,5-dimethylpyrrol-1-yl)benzoic acid. InChIKey: ZLYUUANOICYAAL-UHFFFAOYSA-N.
| Molecular formula | C13H13NO2 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | 2-(2,5-dimethylpyrrol-1-yl)benzoic acid |
| InChIKey | ZLYUUANOICYAAL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(N1C2=CC=CC=C2C(=O)O)C |
Computed by PubChem (NCBI)