cas: 92028-57-4 — see every product listed under this CAS number, including other names
2-(2,5-Dimethyl-1H-pyrrol-1-yl)benzoic acid (CAS 92028-57-4) is a chemical reagent available from Chemat. Available pack sizes: 2mg, 10mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GSBL-2mg |
| cas | 92028-57-4 |
| size | 2mg |
| availability | 0.01g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 2mg | 194.00 Pln | |
| Chemat | 10mg | 352.40 Pln |
| delivery time | 3 weeks |
|---|
2-(2,5-dimethylpyrrol-1-yl)benzoic acid (CAS 92028-57-4) is a chemical compound with the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. IUPAC name: 2-(2,5-dimethylpyrrol-1-yl)benzoic acid. InChIKey: ZLYUUANOICYAAL-UHFFFAOYSA-N.
| Molecular formula | C13H13NO2 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | 2-(2,5-dimethylpyrrol-1-yl)benzoic acid |
| InChIKey | ZLYUUANOICYAAL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(N1C2=CC=CC=C2C(=O)O)C |
Computed by PubChem (NCBI)