cas: 53221-14-0 — see every product listed under this CAS number, including other names
2-(2,7-Dichloro-9H-fluoren-4-yl)oxirane, 95%, 95% (CAS 53221-14-0) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I0HZ-25g |
| cas | 53221-14-0 |
| size | 25g |
| availability | 2500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 150.80 Pln | |
| Chemat | 100g | 338.00 Pln | |
| Chemat | 500g | 1108.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(2,7-dichloro-9H-fluoren-4-yl)oxirane (CAS 53221-14-0) is a chemical compound with the molecular formula C15H10Cl2O and a molecular weight of 277.1 g/mol. IUPAC name: 2-(2,7-dichloro-9H-fluoren-4-yl)oxirane. InChIKey: GVFBXSRAIWZONX-UHFFFAOYSA-N.
| Molecular formula | C15H10Cl2O |
|---|---|
| Molecular weight | 277.1 g/mol |
| IUPAC name | 2-(2,7-dichloro-9H-fluoren-4-yl)oxirane |
| InChIKey | GVFBXSRAIWZONX-UHFFFAOYSA-N |
| SMILES | C1C(O1)C2=CC(=CC3=C2C4=C(C3)C=C(C=C4)Cl)Cl |
Computed by PubChem (NCBI)