cas: 86259-89-4 — see every product listed under this CAS number, including other names
2-(2-(2-(2-((Tetrahydro-2H-pyran-2-yl)oxy)ethoxy)ethoxy)ethoxy)ethyl 4-methylbenzenesulfonate, 95% (CAS 86259-89-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 500mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F870321-100MG |
| cas | 86259-89-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 581.06 Pln | |
| Fluorochem | 500mg | 1903.51 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-[2-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate (CAS 86259-89-4) is a chemical compound with the molecular formula C20H32O8S and a molecular weight of 432.5 g/mol. IUPAC name: 2-[2-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate. InChIKey: AWIUPDGEVFBSGD-UHFFFAOYSA-N.
| Molecular formula | C20H32O8S |
|---|---|
| Molecular weight | 432.5 g/mol |
| IUPAC name | 2-[2-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
| InChIKey | AWIUPDGEVFBSGD-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOCCOCCOCCOC2CCCCO2 |
Computed by PubChem (NCBI)