cas: 86259-89-4 — see every product listed under this CAS number, including other names
2-(2-(2-(2-((Tetrahydro-2H-pyran-2-yl)oxy)ethoxy)ethoxy)ethoxy)ethyl 4-methylbenzenesulfonate, 97%, 97% (CAS 86259-89-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IDZE-50mg |
| cas | 86259-89-4 |
| size | 50mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 347.60 Pln | |
| Chemat | 100mg | 486.80 Pln | |
| Chemat | 250mg | 736.40 Pln | |
| Chemat | 1g | 870.80 Pln | |
| Chemat | 5g | 2757.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-[2-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate (CAS 86259-89-4) is a chemical compound with the molecular formula C20H32O8S and a molecular weight of 432.5 g/mol. IUPAC name: 2-[2-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate. InChIKey: AWIUPDGEVFBSGD-UHFFFAOYSA-N.
| Molecular formula | C20H32O8S |
|---|---|
| Molecular weight | 432.5 g/mol |
| IUPAC name | 2-[2-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
| InChIKey | AWIUPDGEVFBSGD-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOCCOCCOCCOC2CCCCO2 |
Computed by PubChem (NCBI)