cas: 637-84-3 — see every product listed under this CAS number, including other names
2-(2-(2-(2-Aminoacetamido)acetamido)acetamido)acetic acid, 97%, 97% (CAS 637-84-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114UOO-100mg |
| cas | 637-84-3 |
| size | 100mg |
| availability | 18.9g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 299.60 Pln | |
| Chemat | 1g | 722.00 Pln | |
| Chemat | 5g | 2656.40 Pln | |
| Chemat | 10g | 4110.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]acetyl]amino]acetic acid (CAS 637-84-3) is a chemical compound with the molecular formula C8H14N4O5 and a molecular weight of 246.22 g/mol. IUPAC name: 2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]acetyl]amino]acetic acid. InChIKey: QMOQBVOBWVNSNO-UHFFFAOYSA-N.
| Molecular formula | C8H14N4O5 |
|---|---|
| Molecular weight | 246.22 g/mol |
| IUPAC name | 2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]acetyl]amino]acetic acid |
| InChIKey | QMOQBVOBWVNSNO-UHFFFAOYSA-N |
| SMILES | C(C(=O)NCC(=O)NCC(=O)NCC(=O)O)N |
Computed by PubChem (NCBI)