Tetraglycine, 98.09%
cas: 637-84-3 — see every product listed under this CAS number, including other names
Tetraglycine, 98.09% (CAS 637-84-3) is a chemical reagent available from Chemat. Available pack sizes: 100 mg, 5 g, 25 g, 10 g, 1 g, 250 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W142467-100 mg |
| cas | 637-84-3 |
| size | 100 mg |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 100 mg | 240.74 Pln | |
| MedChemExpress | 5 g | 2390.92 Pln | |
| MedChemExpress | 25 g | 10425.04 Pln | |
| MedChemExpress | 10 g | 4299.60 Pln | |
| MedChemExpress | 1 g | 691.21 Pln | |
| MedChemExpress | 250 mg | 361.49 Pln |
properties
| delivery time | 1-2 weeks |
|---|---|
| purity | 98.09% |
2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]acetyl]amino]acetic acid (CAS 637-84-3) is a chemical compound with the molecular formula C8H14N4O5 and a molecular weight of 246.22 g/mol. IUPAC name: 2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]acetyl]amino]acetic acid. InChIKey: QMOQBVOBWVNSNO-UHFFFAOYSA-N.
| Molecular formula | C8H14N4O5 |
|---|---|
| Molecular weight | 246.22 g/mol |
| IUPAC name | 2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]acetyl]amino]acetic acid |
| InChIKey | QMOQBVOBWVNSNO-UHFFFAOYSA-N |
| SMILES | C(C(=O)NCC(=O)NCC(=O)NCC(=O)O)N |
Computed by PubChem (NCBI)