Gly-Gly-Gly-Gly-OH, 97%
cas: 637-84-3 — see every product listed under this CAS number, including other names
Gly-Gly-Gly-Gly-OH, 97% (CAS 637-84-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F493111-250MG |
| cas | 637-84-3 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 320.74 Pln | |
| Fluorochem | 1g | 685.19 Pln | |
| Fluorochem | 5g | 2543.91 Pln | |
| Fluorochem | 10g | 4006.94 Pln | |
| Fluorochem | 25g | 7953.47 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]acetyl]amino]acetic acid (CAS 637-84-3) is a chemical compound with the molecular formula C8H14N4O5 and a molecular weight of 246.22 g/mol. IUPAC name: 2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]acetyl]amino]acetic acid. InChIKey: QMOQBVOBWVNSNO-UHFFFAOYSA-N.
| Molecular formula | C8H14N4O5 |
|---|---|
| Molecular weight | 246.22 g/mol |
| IUPAC name | 2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]acetyl]amino]acetic acid |
| InChIKey | QMOQBVOBWVNSNO-UHFFFAOYSA-N |
| SMILES | C(C(=O)NCC(=O)NCC(=O)NCC(=O)O)N |
Computed by PubChem (NCBI)