cas: 637-84-3 — see every product listed under this CAS number, including other names
Glycylglycylglycylglycine, >97.0%(HPLC)(T) (CAS 637-84-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | G0127-100MG |
| cas | 637-84-3 |
| size | 100mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 100mg | 206.86 Pln | |
| TCI | 1g | 1480.42 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >97.0%(HPLC)(T) |
2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]acetyl]amino]acetic acid (CAS 637-84-3) is a chemical compound with the molecular formula C8H14N4O5 and a molecular weight of 246.22 g/mol. IUPAC name: 2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]acetyl]amino]acetic acid. InChIKey: QMOQBVOBWVNSNO-UHFFFAOYSA-N.
| Molecular formula | C8H14N4O5 |
|---|---|
| Molecular weight | 246.22 g/mol |
| IUPAC name | 2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]acetyl]amino]acetic acid |
| InChIKey | QMOQBVOBWVNSNO-UHFFFAOYSA-N |
| SMILES | C(C(=O)NCC(=O)NCC(=O)NCC(=O)O)N |
Computed by PubChem (NCBI)