cas: 98627-22-6 — see every product listed under this CAS number, including other names
2-(2-(BENZYLOXY)ETHOXY)ETHYL 4-METHYLBENZENESULFONATE, 98% (CAS 98627-22-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F538400-100MG |
| cas | 98627-22-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 107.27 Pln | |
| Fluorochem | 250mg | 122.89 Pln | |
| Fluorochem | 1g | 258.26 Pln | |
| Fluorochem | 5g | 857.01 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-(2-phenylmethoxyethoxy)ethyl 4-methylbenzenesulfonate (CAS 98627-22-6) is a chemical compound with the molecular formula C18H22O5S and a molecular weight of 350.4 g/mol. IUPAC name: 2-(2-phenylmethoxyethoxy)ethyl 4-methylbenzenesulfonate. InChIKey: NFEMXFVBUWGQRW-UHFFFAOYSA-N.
| Molecular formula | C18H22O5S |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | 2-(2-phenylmethoxyethoxy)ethyl 4-methylbenzenesulfonate |
| InChIKey | NFEMXFVBUWGQRW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOCCOCC2=CC=CC=C2 |
Computed by PubChem (NCBI)