cas: 98627-22-6 — see every product listed under this CAS number, including other names
2-(2-(Benzyloxy)ethoxy)ethyl 4-methylbenzenesulfonate, 98%, 98% (CAS 98627-22-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IK6B-250mg |
| cas | 98627-22-6 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 141.20 Pln | |
| Chemat | 1g | 275.60 Pln | |
| Chemat | 5g | 813.20 Pln | |
| Chemat | 100mg | 107.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(2-phenylmethoxyethoxy)ethyl 4-methylbenzenesulfonate (CAS 98627-22-6) is a chemical compound with the molecular formula C18H22O5S and a molecular weight of 350.4 g/mol. IUPAC name: 2-(2-phenylmethoxyethoxy)ethyl 4-methylbenzenesulfonate. InChIKey: NFEMXFVBUWGQRW-UHFFFAOYSA-N.
| Molecular formula | C18H22O5S |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | 2-(2-phenylmethoxyethoxy)ethyl 4-methylbenzenesulfonate |
| InChIKey | NFEMXFVBUWGQRW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOCCOCC2=CC=CC=C2 |
Computed by PubChem (NCBI)