cas: 98627-22-6 — see every product listed under this CAS number, including other names
Benzyl-PEG2-Tos 95% (CAS 98627-22-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A984364-250mg |
| cas | 98627-22-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 270.25 Pln | |
| Ambeed | 5g | 871.00 Pln | |
| Ambeed | 25g | 2879.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A984364 |
2-(2-phenylmethoxyethoxy)ethyl 4-methylbenzenesulfonate (CAS 98627-22-6) is a chemical compound with the molecular formula C18H22O5S and a molecular weight of 350.4 g/mol. IUPAC name: 2-(2-phenylmethoxyethoxy)ethyl 4-methylbenzenesulfonate. InChIKey: NFEMXFVBUWGQRW-UHFFFAOYSA-N.
| Molecular formula | C18H22O5S |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | 2-(2-phenylmethoxyethoxy)ethyl 4-methylbenzenesulfonate |
| InChIKey | NFEMXFVBUWGQRW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOCCOCC2=CC=CC=C2 |
Computed by PubChem (NCBI)