cas: 73150-67-1 — see every product listed under this CAS number, including other names
2-(2-Aminothiazol-4-yl)-2-oxoacetic acid 95% (CAS 73150-67-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A200615-250mg |
| cas | 73150-67-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 420.44 Pln | |
| Ambeed | 5g | 1221.44 Pln | |
| Ambeed | 10g | 2022.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A200615 |
2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetic acid (CAS 73150-67-1) is a chemical compound with the molecular formula C5H4N2O3S and a molecular weight of 172.16 g/mol. IUPAC name: 2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetic acid. InChIKey: VMASTYPGLHRVNL-UHFFFAOYSA-N.
| Molecular formula | C5H4N2O3S |
|---|---|
| Molecular weight | 172.16 g/mol |
| IUPAC name | 2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetic acid |
| InChIKey | VMASTYPGLHRVNL-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(S1)N)C(=O)C(=O)O |
Computed by PubChem (NCBI)