cas: 95154-01-1 — see every product listed under this CAS number, including other names
2-(2-Benzothiazolylthio)butanedioic acid, 98%, 98% (CAS 95154-01-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IIRO-1g |
| cas | 95154-01-1 |
| size | 1g |
| availability | 10000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 69.20 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 93.20 Pln | |
| Chemat | 25g | 131.60 Pln | |
| Chemat | 100g | 285.20 Pln | |
| Chemat | 500g | 1118.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(1,3-benzothiazol-2-ylsulfanyl)butanedioic acid (CAS 95154-01-1) is a chemical compound with the molecular formula C11H9NO4S2 and a molecular weight of 283.3 g/mol. IUPAC name: 2-(1,3-benzothiazol-2-ylsulfanyl)butanedioic acid. InChIKey: KRDSXENYLDIORL-UHFFFAOYSA-N.
| Molecular formula | C11H9NO4S2 |
|---|---|
| Molecular weight | 283.3 g/mol |
| IUPAC name | 2-(1,3-benzothiazol-2-ylsulfanyl)butanedioic acid |
| InChIKey | KRDSXENYLDIORL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)SC(CC(=O)O)C(=O)O |
Computed by PubChem (NCBI)