cas: 95154-01-1 — see every product listed under this CAS number, including other names
2-(Benzo[d]thiazol-2-ylthio)succinic acid 97% (CAS 95154-01-1) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A512146-25g |
| cas | 95154-01-1 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 242.44 Pln | |
| Ambeed | 100g | 592.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A512146 |
2-(1,3-benzothiazol-2-ylsulfanyl)butanedioic acid (CAS 95154-01-1) is a chemical compound with the molecular formula C11H9NO4S2 and a molecular weight of 283.3 g/mol. IUPAC name: 2-(1,3-benzothiazol-2-ylsulfanyl)butanedioic acid. InChIKey: KRDSXENYLDIORL-UHFFFAOYSA-N.
| Molecular formula | C11H9NO4S2 |
|---|---|
| Molecular weight | 283.3 g/mol |
| IUPAC name | 2-(1,3-benzothiazol-2-ylsulfanyl)butanedioic acid |
| InChIKey | KRDSXENYLDIORL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)SC(CC(=O)O)C(=O)O |
Computed by PubChem (NCBI)