cas: 40071-07-6 — see every product listed under this CAS number, including other names
2-(2-Benzoxazolyl)malondialdehyde (CAS 40071-07-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F023406-1G |
| cas | 40071-07-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 919.49 Pln | |
| Fluorochem | 5g | 3194.73 Pln | |
| Fluorochem | 10g | 3205.14 Pln | |
| Fluorochem | 25g | 6313.42 Pln |
| delivery time | 2-3 weeks |
|---|
2-(1,3-benzoxazol-2-yl)propanedial (CAS 40071-07-6) is a chemical compound with the molecular formula C10H7NO3 and a molecular weight of 189.17 g/mol. IUPAC name: 2-(1,3-benzoxazol-2-yl)propanedial. InChIKey: MEERYQZEXZMOGC-UHFFFAOYSA-N.
| Molecular formula | C10H7NO3 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 2-(1,3-benzoxazol-2-yl)propanedial |
| InChIKey | MEERYQZEXZMOGC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(O2)C(C=O)C=O |
Computed by PubChem (NCBI)