CAS 18718-84-8 appears in our catalog under these names: 3-Phenyl-4-isoxazolecarboxylic acid, 95%, 3-Phenylisoxazole-4-carboxylic acid, 3-Phenylisoxazole-4-carboxylic acid 98%, 3-Phenylisoxazole-4-carboxylic acid, 98%, 98%, 3-phenyl-4-isoxazolecarboxylic acid, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 5g, 250mg.
3-phenyl-1,2-oxazole-4-carboxylic acid (CAS 18718-84-8) is a chemical compound with the molecular formula C10H7NO3 and a molecular weight of 189.17 g/mol. IUPAC name: 3-phenyl-1,2-oxazole-4-carboxylic acid. InChIKey: SZKVGVRLYVFVFP-UHFFFAOYSA-N.
| Molecular formula | C10H7NO3 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 3-phenyl-1,2-oxazole-4-carboxylic acid |
| InChIKey | SZKVGVRLYVFVFP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NOC=C2C(=O)O |
Computed by PubChem (NCBI)