Products 208772-46-7
CAS 208772-46-7 appears in our catalog under these names: 3-Formyl-1H-indole-4-carboxylic acid, 96%, 3–Formyl–1H–indole–4–carboxylic acid, 3-Formyl-1H-indole-4-carboxylic acid, 3-Formyl-1H-indole-4-carboxylic acid 98%, 3-Formyl-1H-indole-4-carboxylic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 10g, 100mg, 0,5g.
3-formyl-1H-indole-4-carboxylic acid (CAS 208772-46-7) is a chemical compound with the molecular formula C10H7NO3 and a molecular weight of 189.17 g/mol. IUPAC name: 3-formyl-1H-indole-4-carboxylic acid. InChIKey: GLURRHBQBOQINO-UHFFFAOYSA-N.
| Molecular formula | C10H7NO3 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 3-formyl-1H-indole-4-carboxylic acid |
| InChIKey | GLURRHBQBOQINO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)NC=C2C=O)C(=O)O |
Computed by PubChem (NCBI)