CAS 21640-33-5 appears in our catalog under these names: 2-Methyl-isoquinoline-1,3,4-trione, 95%, 2-Methylisoquinoline-1,3,4(2H)-trione, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 250mg.
2-methylisoquinoline-1,3,4-trione (CAS 21640-33-5) is a chemical compound with the molecular formula C10H7NO3 and a molecular weight of 189.17 g/mol. IUPAC name: 2-methylisoquinoline-1,3,4-trione. InChIKey: LSVJISCDJHIYOW-UHFFFAOYSA-N.
| Molecular formula | C10H7NO3 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 2-methylisoquinoline-1,3,4-trione |
| InChIKey | LSVJISCDJHIYOW-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C2=CC=CC=C2C(=O)C1=O |
Computed by PubChem (NCBI)