cas: 2169687-26-5 — see every product listed under this CAS number, including other names
2-(2-Brom-3-fluorophenyl)-1,3-dioxolane (CAS 2169687-26-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F630984-5G |
| cas | 2169687-26-5 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 1278.73 Pln | |
| Fluorochem | 10g | 2132.60 Pln |
| delivery time | 3-4 weeks |
|---|
2-(2-bromo-3-fluorophenyl)-1,3-dioxolane (CAS 2169687-26-5) is a chemical compound with the molecular formula C9H8BrFO2 and a molecular weight of 247.06 g/mol. IUPAC name: 2-(2-bromo-3-fluorophenyl)-1,3-dioxolane. InChIKey: WELJJYIBVDPPLN-UHFFFAOYSA-N.
| Molecular formula | C9H8BrFO2 |
|---|---|
| Molecular weight | 247.06 g/mol |
| IUPAC name | 2-(2-bromo-3-fluorophenyl)-1,3-dioxolane |
| InChIKey | WELJJYIBVDPPLN-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=C(C(=CC=C2)F)Br |
Computed by PubChem (NCBI)