CAS 1261775-91-0 appears in our catalog under these names: 3-(2-Bromo-6-fluorophenyl)propanoic acid, 98%, 3-(2-Bromo-6-fluorophenyl)propanoic acid, 3-(2-Bromo-6-fluorophenyl)propanoic acid, 98%, 98%. Offered by: Combi-blocks, Biosynth, Chemat. Available pack sizes: 1g, 5g, 2,5g, 250mg, 500mg.
3-(2-bromo-6-fluorophenyl)propanoic acid (CAS 1261775-91-0) is a chemical compound with the molecular formula C9H8BrFO2 and a molecular weight of 247.06 g/mol. IUPAC name: 3-(2-bromo-6-fluorophenyl)propanoic acid. InChIKey: UTLGOOMCDSXMPN-UHFFFAOYSA-N.
| Molecular formula | C9H8BrFO2 |
|---|---|
| Molecular weight | 247.06 g/mol |
| IUPAC name | 3-(2-bromo-6-fluorophenyl)propanoic acid |
| InChIKey | UTLGOOMCDSXMPN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)CCC(=O)O)F |
Computed by PubChem (NCBI)