cas: 2221812-20-8 — see every product listed under this CAS number, including other names
2-(2-Bromo-6-(trifluoromethoxy)phenyl)-1,3-dioxolane, 98% (CAS 2221812-20-8) is a chemical reagent available from Chemat. Available pack sizes: 25g, 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1630511-25g |
| cas | 2221812-20-8 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 51948.19 Pln | |
| AmBeed | 5g | 15557.29 Pln | |
| AmBeed | 10g | 26474.56 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-[2-bromo-6-(trifluoromethoxy)phenyl]-1,3-dioxolane (CAS 2221812-20-8) is a chemical compound with the molecular formula C10H8BrF3O3 and a molecular weight of 313.07 g/mol. IUPAC name: 2-[2-bromo-6-(trifluoromethoxy)phenyl]-1,3-dioxolane. InChIKey: LWWPZLRUGZVDRE-UHFFFAOYSA-N.
| Molecular formula | C10H8BrF3O3 |
|---|---|
| Molecular weight | 313.07 g/mol |
| IUPAC name | 2-[2-bromo-6-(trifluoromethoxy)phenyl]-1,3-dioxolane |
| InChIKey | LWWPZLRUGZVDRE-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=C(C=CC=C2Br)OC(F)(F)F |
Computed by PubChem (NCBI)