CAS 1214337-88-8 appears in our catalog under these names: 2-Bromo-4-(trifluoromethoxy)benzoic acid ethyl ester, 95%, 2-Bromo-4-(trifluoromethoxy)benzoic acid ethyl ester, ≥95%, ≥95%, 2-Bromo-4-(trifluoromethoxy)benzoic acid ethyl ester, ≥95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 250mg, 1g.
Ethyl 2-bromo-4-(trifluoromethoxy)benzoate (CAS 1214337-88-8) is a chemical compound with the molecular formula C10H8BrF3O3 and a molecular weight of 313.07 g/mol. IUPAC name: ethyl 2-bromo-4-(trifluoromethoxy)benzoate. InChIKey: KZYMJZRQLXDFIR-UHFFFAOYSA-N.
| Molecular formula | C10H8BrF3O3 |
|---|---|
| Molecular weight | 313.07 g/mol |
| IUPAC name | ethyl 2-bromo-4-(trifluoromethoxy)benzoate |
| InChIKey | KZYMJZRQLXDFIR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(C=C1)OC(F)(F)F)Br |
Computed by PubChem (NCBI)