CAS 773135-66-3 is the registry number for Ethyl 5-bromo-2-(trifluoromethoxy)benzoate, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Ethyl 5-bromo-2-(trifluoromethoxy)benzoate (CAS 773135-66-3) is a chemical compound with the molecular formula C10H8BrF3O3 and a molecular weight of 313.07 g/mol. IUPAC name: ethyl 5-bromo-2-(trifluoromethoxy)benzoate. InChIKey: SLKPMXBBJPIOPB-UHFFFAOYSA-N.
| Molecular formula | C10H8BrF3O3 |
|---|---|
| Molecular weight | 313.07 g/mol |
| IUPAC name | ethyl 5-bromo-2-(trifluoromethoxy)benzoate |
| InChIKey | SLKPMXBBJPIOPB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1)Br)OC(F)(F)F |
Computed by PubChem (NCBI)