CAS 1255707-64-2 is the registry number for 4-Bromo-3-(2,2,2-trifluoro-ethoxy)-benzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
Methyl 4-bromo-3-(2,2,2-trifluoroethoxy)benzoate (CAS 1255707-64-2) is a chemical compound with the molecular formula C10H8BrF3O3 and a molecular weight of 313.07 g/mol. IUPAC name: methyl 4-bromo-3-(2,2,2-trifluoroethoxy)benzoate. InChIKey: KIUAWNHTCCQVBP-UHFFFAOYSA-N.
| Molecular formula | C10H8BrF3O3 |
|---|---|
| Molecular weight | 313.07 g/mol |
| IUPAC name | methyl 4-bromo-3-(2,2,2-trifluoroethoxy)benzoate |
| InChIKey | KIUAWNHTCCQVBP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)Br)OCC(F)(F)F |
Computed by PubChem (NCBI)