cas: 2221812-14-0 — see every product listed under this CAS number, including other names
2-(2-Bromo-6-fluoro-3-methylphenyl)-1,3-dioxolane (CAS 2221812-14-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F631015-1G |
| cas | 2221812-14-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1939.96 Pln | |
| Fluorochem | 5g | 5673.02 Pln |
| delivery time | 3-4 weeks |
|---|
2-(2-bromo-6-fluoro-3-methylphenyl)-1,3-dioxolane (CAS 2221812-14-0) is a chemical compound with the molecular formula C10H10BrFO2 and a molecular weight of 261.09 g/mol. IUPAC name: 2-(2-bromo-6-fluoro-3-methylphenyl)-1,3-dioxolane. InChIKey: JXMSURODKFEQCV-UHFFFAOYSA-N.
| Molecular formula | C10H10BrFO2 |
|---|---|
| Molecular weight | 261.09 g/mol |
| IUPAC name | 2-(2-bromo-6-fluoro-3-methylphenyl)-1,3-dioxolane |
| InChIKey | JXMSURODKFEQCV-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)F)C2OCCO2)Br |
Computed by PubChem (NCBI)