cas: 16897-97-5 — see every product listed under this CAS number, including other names
2-(2-Bromophenyl)acetophenone, 97%, 97% (CAS 16897-97-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112YFA-100mg |
| cas | 16897-97-5 |
| size | 100mg |
| availability | 0.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 290.00 Pln | |
| Chemat | 250mg | 491.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(2-bromophenyl)-1-phenylethanone (CAS 16897-97-5) is a chemical compound with the molecular formula C14H11BrO and a molecular weight of 275.14 g/mol. IUPAC name: 2-(2-bromophenyl)-1-phenylethanone. InChIKey: KJKUTYSDSVMXDM-UHFFFAOYSA-N.
| Molecular formula | C14H11BrO |
|---|---|
| Molecular weight | 275.14 g/mol |
| IUPAC name | 2-(2-bromophenyl)-1-phenylethanone |
| InChIKey | KJKUTYSDSVMXDM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)CC2=CC=CC=C2Br |
Computed by PubChem (NCBI)