CAS 73932-62-4 is the registry number for 1-([1,1'-Biphenyl]-3-yl)-2-bromoethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-1-(3-phenylphenyl)ethanone (CAS 73932-62-4) is a chemical compound with the molecular formula C14H11BrO and a molecular weight of 275.14 g/mol. IUPAC name: 2-bromo-1-(3-phenylphenyl)ethanone. InChIKey: VYSQSOFKGTXQBG-UHFFFAOYSA-N.
| Molecular formula | C14H11BrO |
|---|---|
| Molecular weight | 275.14 g/mol |
| IUPAC name | 2-bromo-1-(3-phenylphenyl)ethanone |
| InChIKey | VYSQSOFKGTXQBG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC=C2)C(=O)CBr |
Computed by PubChem (NCBI)