CAS 76693-57-7 appears in our catalog under these names: 4-Bromo-4'-methylbenzophenone, 98%, (4-Bromophenyl)(p-tolyl)methanone, 98%, (4-Bromophenyl)(p-tolyl)methanone, 95%, 95%, 4-Bromo-4'-methylbenzophenone, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 100mg, 250mg.
(4-bromophenyl)-(4-methylphenyl)methanone (CAS 76693-57-7) is a chemical compound with the molecular formula C14H11BrO and a molecular weight of 275.14 g/mol. IUPAC name: (4-bromophenyl)-(4-methylphenyl)methanone. InChIKey: HYLHMBIFGKMXHZ-UHFFFAOYSA-N.
| Molecular formula | C14H11BrO |
|---|---|
| Molecular weight | 275.14 g/mol |
| IUPAC name | (4-bromophenyl)-(4-methylphenyl)methanone |
| InChIKey | HYLHMBIFGKMXHZ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)