Products 27428-59-7
CAS 27428-59-7 appears in our catalog under these names: 4-Bromo-2'-methylbenzophenone, 97%, 4-Bromo-2'-methylbenzophenone, 4-Bromo-2'-methylbenzophenone, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 10g.
(4-bromophenyl)-(2-methylphenyl)methanone (CAS 27428-59-7) is a chemical compound with the molecular formula C14H11BrO and a molecular weight of 275.14 g/mol. IUPAC name: (4-bromophenyl)-(2-methylphenyl)methanone. InChIKey: POHRRVPQMJGTKX-UHFFFAOYSA-N.
| Molecular formula | C14H11BrO |
|---|---|
| Molecular weight | 275.14 g/mol |
| IUPAC name | (4-bromophenyl)-(2-methylphenyl)methanone |
| InChIKey | POHRRVPQMJGTKX-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)