2-(2-Fluoro-3-isopropoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 98+%
cas: 1451391-00-6 — see every product listed under this CAS number, including other names
2-(2-Fluoro-3-isopropoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 98+% (CAS 1451391-00-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A819623-100mg |
| cas | 1451391-00-6 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 264.69 Pln | |
| Ambeed | 250mg | 309.19 Pln | |
| Ambeed | 1g | 398.19 Pln | |
| Ambeed | 5g | 1666.44 Pln | |
| Ambeed | 25g | 5921.75 Pln |
properties
| purity | 98+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A819623 |
2-(2-fluoro-3-propan-2-yloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1451391-00-6) is a chemical compound with the molecular formula C15H22BFO3 and a molecular weight of 280.14 g/mol. IUPAC name: 2-(2-fluoro-3-propan-2-yloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: DSIBMZWYVMJDAZ-UHFFFAOYSA-N.
| Molecular formula | C15H22BFO3 |
|---|---|
| Molecular weight | 280.14 g/mol |
| IUPAC name | 2-(2-fluoro-3-propan-2-yloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | DSIBMZWYVMJDAZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)OC(C)C)F |
Computed by PubChem (NCBI)
Synonyms:
2-Fluoro-3-isopropoxyphenylboronic acid pinacol ester, 2-(2-Fluoro-3-isopropoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 2-(2-fluoro-3-propan-2-yloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 2-[2-Fluoro-3-(1-methylethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 2-(2-Fluoro-3-isopropoxy-phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 2-[2-fluoro-3-(propan-2-yloxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 2-{2-Fluoro-3-[(propan-2-yl)oxy]phenyl}-4,4,5,5-tetramethyl-1,3,2-dioxaborolane