2-(2-Fluoro-5-isopropoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 97%
cas: 2121514-44-9 — see every product listed under this CAS number, including other names
2-(2-Fluoro-5-isopropoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 97% (CAS 2121514-44-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A653228-1g |
| cas | 2121514-44-9 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 882.12 Pln | |
| Ambeed | 10g | 1482.88 Pln | |
| Ambeed | 25g | 2873.50 Pln | |
| Ambeed | 100g | 7874.19 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A653228 |
2-(2-fluoro-5-propan-2-yloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121514-44-9) is a chemical compound with the molecular formula C15H22BFO3 and a molecular weight of 280.14 g/mol. IUPAC name: 2-(2-fluoro-5-propan-2-yloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: FFQFAIKPMJDPEH-UHFFFAOYSA-N.
| Molecular formula | C15H22BFO3 |
|---|---|
| Molecular weight | 280.14 g/mol |
| IUPAC name | 2-(2-fluoro-5-propan-2-yloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | FFQFAIKPMJDPEH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)OC(C)C)F |
Computed by PubChem (NCBI)
Synonyms:
2-(2-fluoro-5-isopropoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 2-Fluoro-5-isoproproxyphenylboronic acid pinacol ester, 2-Fluoro-5-isopropoxyphenylboronic acid pinacol ester, 2-(2-fluoro-5-isopropoxy-phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 1,3,2-Dioxaborolane, 2-[2-fluoro-5-(1-methylethoxy)phenyl]-4,4,5,5-tetramethyl-, 2-(2-fluoro-5-propan-2-yloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane