cas: 2121514-44-9 — see every product listed under this CAS number, including other names
2-(2-Fluoro-5-isopropoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121514-44-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F627409-5G |
| cas | 2121514-44-9 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 1294.35 Pln | |
| Fluorochem | 10g | 2153.43 Pln |
| delivery time | 3-4 weeks |
|---|
2-(2-fluoro-5-propan-2-yloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121514-44-9) is a chemical compound with the molecular formula C15H22BFO3 and a molecular weight of 280.14 g/mol. IUPAC name: 2-(2-fluoro-5-propan-2-yloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: FFQFAIKPMJDPEH-UHFFFAOYSA-N.
| Molecular formula | C15H22BFO3 |
|---|---|
| Molecular weight | 280.14 g/mol |
| IUPAC name | 2-(2-fluoro-5-propan-2-yloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | FFQFAIKPMJDPEH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)OC(C)C)F |
Computed by PubChem (NCBI)