2-(2-Fluoro-5-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%
cas: 1192045-84-3 — see every product listed under this CAS number, including other names
2-(2-Fluoro-5-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97% (CAS 1192045-84-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch111IDV-100mg |
| cas | 1192045-84-3 |
| size | 100mg |
| availability | 100g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 270.80 Pln | |
| Chemat | 10g | 419.60 Pln | |
| Chemat | 25g | 818.00 Pln | |
| Chemat | 50g | 1442.00 Pln | |
| Fluorochem | 250mg | 102.06 Pln | |
| Fluorochem | 1g | 154.13 Pln | |
| Fluorochem | 5g | 414.46 Pln | |
| Fluorochem | 10g | 747.67 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(2-fluoro-5-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1192045-84-3) is a chemical compound with the molecular formula C13H18BFO2 and a molecular weight of 236.09 g/mol. IUPAC name: 2-(2-fluoro-5-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: XPBIIDZQZBLHMB-UHFFFAOYSA-N.
| Molecular formula | C13H18BFO2 |
|---|---|
| Molecular weight | 236.09 g/mol |
| IUPAC name | 2-(2-fluoro-5-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | XPBIIDZQZBLHMB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)C)F |
Computed by PubChem (NCBI)