CAS 1192045-84-3 is the registry number for 2-(2-Fluoro-5-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%. Offered by: Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g.
2-(2-fluoro-5-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1192045-84-3) is a chemical compound with the molecular formula C13H18BFO2 and a molecular weight of 236.09 g/mol. IUPAC name: 2-(2-fluoro-5-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: XPBIIDZQZBLHMB-UHFFFAOYSA-N.
| Molecular formula | C13H18BFO2 |
|---|---|
| Molecular weight | 236.09 g/mol |
| IUPAC name | 2-(2-fluoro-5-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | XPBIIDZQZBLHMB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)C)F |
Computed by PubChem (NCBI)