cas: 1257553-79-9 — see every product listed under this CAS number, including other names
2-(2-Methoxyethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine 98% (CAS 1257553-79-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A218311-250mg |
| cas | 1257553-79-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 264.69 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 776.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A218311 |
2-(2-methoxyethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1257553-79-9) is a chemical compound with the molecular formula C14H22BNO4 and a molecular weight of 279.14 g/mol. IUPAC name: 2-(2-methoxyethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: XXIFFWUJVLUWSG-UHFFFAOYSA-N.
| Molecular formula | C14H22BNO4 |
|---|---|
| Molecular weight | 279.14 g/mol |
| IUPAC name | 2-(2-methoxyethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | XXIFFWUJVLUWSG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2)OCCOC |
Computed by PubChem (NCBI)