cas: 1257553-79-9 — see every product listed under this CAS number, including other names
2-(2-Methoxyethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 98%, 98% (CAS 1257553-79-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111OMV-100mg |
| cas | 1257553-79-9 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 208.40 Pln | |
| Chemat | 5g | 640.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(2-methoxyethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1257553-79-9) is a chemical compound with the molecular formula C14H22BNO4 and a molecular weight of 279.14 g/mol. IUPAC name: 2-(2-methoxyethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: XXIFFWUJVLUWSG-UHFFFAOYSA-N.
| Molecular formula | C14H22BNO4 |
|---|---|
| Molecular weight | 279.14 g/mol |
| IUPAC name | 2-(2-methoxyethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | XXIFFWUJVLUWSG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2)OCCOC |
Computed by PubChem (NCBI)