Products 2377608-47-2

CAS 2377608-47-2 is the registry number for 4-(N-BOC-N-Propylamino)phenylboronic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g.

Structural formula: {0} (CAS {1})

[4-[(2-methylpropan-2-yl)oxycarbonyl-propylamino]phenyl]boronic acid (CAS 2377608-47-2) is a chemical compound with the molecular formula C14H22BNO4 and a molecular weight of 279.14 g/mol. IUPAC name: [4-[(2-methylpropan-2-yl)oxycarbonyl-propylamino]phenyl]boronic acid. InChIKey: BRWQBZOIHHLYAX-UHFFFAOYSA-N.

Identity
Molecular formulaC14H22BNO4
Molecular weight279.14 g/mol
IUPAC name[4-[(2-methylpropan-2-yl)oxycarbonyl-propylamino]phenyl]boronic acid
InChIKeyBRWQBZOIHHLYAX-UHFFFAOYSA-N
SMILESB(C1=CC=C(C=C1)N(CCC)C(=O)OC(C)(C)C)(O)O

Computed by PubChem (NCBI)