cas: 1257553-79-9 — see every product listed under this CAS number, including other names
2-(2-Methoxyethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 98% (CAS 1257553-79-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F326038-1G |
| cas | 1257553-79-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 315.53 Pln | |
| Fluorochem | 5g | 763.29 Pln | |
| Fluorochem | 10g | 1471.37 Pln | |
| Fluorochem | 25g | 3590.42 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-(2-methoxyethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1257553-79-9) is a chemical compound with the molecular formula C14H22BNO4 and a molecular weight of 279.14 g/mol. IUPAC name: 2-(2-methoxyethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: XXIFFWUJVLUWSG-UHFFFAOYSA-N.
| Molecular formula | C14H22BNO4 |
|---|---|
| Molecular weight | 279.14 g/mol |
| IUPAC name | 2-(2-methoxyethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | XXIFFWUJVLUWSG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2)OCCOC |
Computed by PubChem (NCBI)