cas: 1181373-40-9 — see every product listed under this CAS number, including other names
2-(2-Methylimidazo(2,1-b)thiazol-6-yl)acetic acid, 98+% (CAS 1181373-40-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A415016-1g |
| cas | 1181373-40-9 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 6762.28 Pln | |
| AmBeed | 5g | 22464.40 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(2-methylimidazo[2,1-b][1,3]thiazol-6-yl)acetic acid (CAS 1181373-40-9) is a chemical compound with the molecular formula C8H8N2O2S and a molecular weight of 196.23 g/mol. IUPAC name: 2-(2-methylimidazo[2,1-b][1,3]thiazol-6-yl)acetic acid. InChIKey: DMFXCYUDQZPWFQ-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O2S |
|---|---|
| Molecular weight | 196.23 g/mol |
| IUPAC name | 2-(2-methylimidazo[2,1-b][1,3]thiazol-6-yl)acetic acid |
| InChIKey | DMFXCYUDQZPWFQ-UHFFFAOYSA-N |
| SMILES | CC1=CN2C=C(N=C2S1)CC(=O)O |
Computed by PubChem (NCBI)