cas: 81745-21-3 — see every product listed under this CAS number, including other names
2-(2-Oxo-3,4-Dihydroquinolin-1(2H)-Yl)Acetic Acid, 96%, 96% (CAS 81745-21-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G8TT-100mg |
| cas | 81745-21-3 |
| size | 100mg |
| availability | 0.2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2-(2-oxo-3,4-dihydroquinolin-1-yl)acetic acid (CAS 81745-21-3) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: 2-(2-oxo-3,4-dihydroquinolin-1-yl)acetic acid. InChIKey: LQGIKCCIECNYHT-UHFFFAOYSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | 2-(2-oxo-3,4-dihydroquinolin-1-yl)acetic acid |
| InChIKey | LQGIKCCIECNYHT-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C2=CC=CC=C21)CC(=O)O |
Computed by PubChem (NCBI)