CAS 78027-57-3 appears in our catalog under these names: 1–BENZYL–3–HYDROXY–PYRROLIDINE–2,5–DIONE, 1-Benzyl-3-hydroxypyrrolidine-2,5-dione, 97%, 1-Benzyl-3-hydroxy-pyrrolidine-2,5-dione, 97%, 1-Benzyl-3-hydroxypyrrolidine-2,5-dione, 97%, 97%. Offered by: GLPBio, Ambeed, Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 10g.
1-benzyl-3-hydroxypyrrolidine-2,5-dione (CAS 78027-57-3) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: 1-benzyl-3-hydroxypyrrolidine-2,5-dione. InChIKey: VCPKAWKGCQTPCR-UHFFFAOYSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | 1-benzyl-3-hydroxypyrrolidine-2,5-dione |
| InChIKey | VCPKAWKGCQTPCR-UHFFFAOYSA-N |
| SMILES | C1C(C(=O)N(C1=O)CC2=CC=CC=C2)O |
Computed by PubChem (NCBI)