cas: 57479-60-4 — see every product listed under this CAS number, including other names
2-(2-chlorophenyl)acetophenone, 97% (CAS 57479-60-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F203754-50MG |
| cas | 57479-60-4 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 315.53 Pln | |
| Fluorochem | 100mg | 445.69 Pln | |
| Fluorochem | 250mg | 607.10 Pln | |
| Fluorochem | 500mg | 935.11 Pln | |
| Fluorochem | 1g | 1185.02 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-(2-chlorophenyl)-1-phenylethanone (CAS 57479-60-4) is a chemical compound with the molecular formula C14H11ClO and a molecular weight of 230.69 g/mol. IUPAC name: 2-(2-chlorophenyl)-1-phenylethanone. InChIKey: AMQKCOCKRZUDKQ-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO |
|---|---|
| Molecular weight | 230.69 g/mol |
| IUPAC name | 2-(2-chlorophenyl)-1-phenylethanone |
| InChIKey | AMQKCOCKRZUDKQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)CC2=CC=CC=C2Cl |
Computed by PubChem (NCBI)