2-(2-iodoethyl)isoindoline-1,3-dione, 95%
cas: 40149-83-5 — see every product listed under this CAS number, including other names
2-(2-iodoethyl)isoindoline-1,3-dione, 95% (CAS 40149-83-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch11CLEZ-100mg |
| cas | 40149-83-5 |
| size | 100mg |
| availability | 11.97g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 371.60 Pln | |
| Chemat | 250mg | 611.60 Pln | |
| Chemat | 1g | 1096.40 Pln | |
| Chemat | 5g | 2474.00 Pln | |
| Chemat | 10g | 4197.20 Pln | |
| Fluorochem | 250mg | 1122.54 Pln | |
| Fluorochem | 1g | 2028.47 Pln | |
| Fluorochem | 5g | 4584.86 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(2-iodoethyl)isoindole-1,3-dione (CAS 40149-83-5) is a chemical compound with the molecular formula C10H8INO2 and a molecular weight of 301.08 g/mol. IUPAC name: 2-(2-iodoethyl)isoindole-1,3-dione. InChIKey: IMUTXBXKJDBQOY-UHFFFAOYSA-N.
| Molecular formula | C10H8INO2 |
|---|---|
| Molecular weight | 301.08 g/mol |
| IUPAC name | 2-(2-iodoethyl)isoindole-1,3-dione |
| InChIKey | IMUTXBXKJDBQOY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCI |
Computed by PubChem (NCBI)