CAS 371765-16-1 is the registry number for Ethyl 4-cyano-3-iodobenzoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
Ethyl 4-cyano-3-iodobenzoate (CAS 371765-16-1) is a chemical compound with the molecular formula C10H8INO2 and a molecular weight of 301.08 g/mol. IUPAC name: ethyl 4-cyano-3-iodobenzoate. InChIKey: VJNQGXXEHMTDGA-UHFFFAOYSA-N.
| Molecular formula | C10H8INO2 |
|---|---|
| Molecular weight | 301.08 g/mol |
| IUPAC name | ethyl 4-cyano-3-iodobenzoate |
| InChIKey | VJNQGXXEHMTDGA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)C#N)I |
Computed by PubChem (NCBI)