CAS 1190972-41-8 appears in our catalog under these names: 3-Iodo-6-methoxy-1h-quinolin-4-one, 95%, 3-Iodo-6-methoxy-quinolin-4-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-iodo-6-methoxy-1H-quinolin-4-one (CAS 1190972-41-8) is a chemical compound with the molecular formula C10H8INO2 and a molecular weight of 301.08 g/mol. IUPAC name: 3-iodo-6-methoxy-1H-quinolin-4-one. InChIKey: PVVNUDPHTMKOSB-UHFFFAOYSA-N.
| Molecular formula | C10H8INO2 |
|---|---|
| Molecular weight | 301.08 g/mol |
| IUPAC name | 3-iodo-6-methoxy-1H-quinolin-4-one |
| InChIKey | PVVNUDPHTMKOSB-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)NC=C(C2=O)I |
Computed by PubChem (NCBI)