CAS 1934418-77-5 is the registry number for Methyl 4-iodo-1H-indole-2-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl 4-iodo-1H-indole-2-carboxylate (CAS 1934418-77-5) is a chemical compound with the molecular formula C10H8INO2 and a molecular weight of 301.08 g/mol. IUPAC name: methyl 4-iodo-1H-indole-2-carboxylate. InChIKey: QJJKBLGPGQTMQO-UHFFFAOYSA-N.
| Molecular formula | C10H8INO2 |
|---|---|
| Molecular weight | 301.08 g/mol |
| IUPAC name | methyl 4-iodo-1H-indole-2-carboxylate |
| InChIKey | QJJKBLGPGQTMQO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(N1)C=CC=C2I |
Computed by PubChem (NCBI)