2-(3,4-Diethoxyphenyl)acetic acid, 98+%
cas: 38464-04-9 — see every product listed under this CAS number, including other names
2-(3,4-Diethoxyphenyl)acetic acid, 98+% (CAS 38464-04-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A212524-1g |
| cas | 38464-04-9 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 164.56 Pln | |
| Ambeed | 5g | 426.00 Pln | |
| Ambeed | 25g | 1310.44 Pln | |
| Ambeed | 100g | 3785.75 Pln | |
| Chemat | 1g | 150.80 Pln | |
| Chemat | 5g | 386.00 Pln | |
| Chemat | 25g | 1240.40 Pln | |
| Chemat | 100g | 3938.00 Pln | |
| BLDpharm | 1g | 169.96 Pln | |
| BLDpharm | 5g | 453.20 Pln | |
| BLDpharm | 25g | 1402.86 Pln | |
| BLDpharm | 100g | 4074.15 Pln |
properties
| purity | 98+% |
|---|---|
| delivery time | 2-3 weeks |
2-(3,4-diethoxyphenyl)acetic acid (CAS 38464-04-9) is a chemical compound with the molecular formula C12H16O4 and a molecular weight of 224.25 g/mol. IUPAC name: 2-(3,4-diethoxyphenyl)acetic acid. InChIKey: FIKUHWAANCXBGJ-UHFFFAOYSA-N.
| Molecular formula | C12H16O4 |
|---|---|
| Molecular weight | 224.25 g/mol |
| IUPAC name | 2-(3,4-diethoxyphenyl)acetic acid |
| InChIKey | FIKUHWAANCXBGJ-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)CC(=O)O)OCC |
Computed by PubChem (NCBI)
Synonyms:
3,4-Diethoxyphenylacetic acid, 2-(3,4-diethoxyphenyl)acetic acid, (3,4-diethoxyphenyl)acetic acid, 3,4-Diethoxyphenyl Acetic Acid, (3,4-Diethoxy-phenyl)-acetic acid, 3,4-diethoxy-phenylacetic acid, Drotaverine Impurity 1, 3,4-Diethoxyphenylaceticacid, Benzeneacetic acid, 3,4-diethoxy-, Cambridge id 7186671